134-94-1 Usage
Uses
Used in Chemical Synthesis:
4-[ethyl(2-hydroxyethyl)amino]benzenediazonium chloride is used as a precursor in the synthesis of various organic compounds, particularly azo dyes. Its unique structure allows for versatile reactions and the creation of a wide range of dyes with different properties.
Used in Research:
In the field of scientific research, 4-[ethyl(2-hydroxyethyl)amino]benzenediazonium chloride serves as a valuable compound for studying the properties and reactions of diazonium salts. It aids in understanding the mechanisms of dye synthesis and the behavior of nitrogen-nitrogen bonds in chemical reactions.
Used in Dye Production:
4-[ethyl(2-hydroxyethyl)amino]benzenediazonium chloride is used as a key intermediate in the production of azo dyes in the dye industry. Its role in creating dyes with specific color characteristics and properties is essential for various applications, including textiles, plastics, and printing inks.
Used in Analytical Chemistry:
In analytical chemistry, 4-[ethyl(2-hydroxyethyl)amino]benzenediazonium chloride can be employed as a reagent for the detection and analysis of certain compounds. Its strong oxidizing nature makes it suitable for specific analytical techniques that require such properties.
Used in Pharmaceutical Industry:
Although not explicitly mentioned in the provided materials, given its complex structure and reactivity, 4-[ethyl(2-hydroxyethyl)amino]benzenediazonium chloride could potentially be used in the pharmaceutical industry for the development of new drugs or as an intermediate in the synthesis of pharmaceutical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 134-94-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,3 and 4 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 134-94:
(5*1)+(4*3)+(3*4)+(2*9)+(1*4)=51
51 % 10 = 1
So 134-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N3O.ClH/c1-2-13(7-8-14)10-5-3-9(12-11)4-6-10;/h3-6,14H,2,7-8H2,1H3;1H/q+1;/p-1
