134318-72-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Pyrimidineacetonitrile, 4-amino(9CI) is used as a building block for the synthesis of various drugs and pharmaceuticals. Its potential pharmaceutical applications include the development of new drugs with antibacterial, antiviral, and antifungal properties, making it a valuable compound for disease treatment.
Used in Organic Chemistry:
2-Pyrimidineacetonitrile, 4-amino(9CI) is used as a versatile intermediate in the synthesis of various organic compounds. Its unique structure and functional groups make it a useful component in the development of new organic molecules with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 134318-72-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,3,1 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 134318-72:
(8*1)+(7*3)+(6*4)+(5*3)+(4*1)+(3*8)+(2*7)+(1*2)=112
112 % 10 = 2
So 134318-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-3-1-6-9-4-2-5(8)10-6/h2,4H,1H2,(H2,8,9,10)
