134355-31-0 Usage
Uses
Used in Pharmaceutical Industry:
Methylidopyranosiduronic acid is used as a pharmaceutical intermediate for the synthesis of various drugs and therapeutic agents. Its unique chemical properties and reactivity make it a valuable building block in the development of new pharmaceutical compounds.
Used in Research and Development:
Methylidopyranosiduronic acid is used as a research compound in the study of carbohydrate chemistry, glycobiology, and the development of new glycosylation methods. Its structural features and reactivity provide insights into the synthesis and properties of complex carbohydrates and their interactions with proteins and other biomolecules.
Used in Diagnostic Applications:
Methylidopyranosiduronic acid can be used as a diagnostic marker or reagent in the detection and analysis of various diseases and conditions. Its unique chemical properties and reactivity can be exploited to develop new diagnostic assays and methods for the early detection and monitoring of diseases.
Used in Food Industry:
Methylidopyranosiduronic acid can be used as a food additive or ingredient in the development of new food products and formulations. Its unique properties and reactivity can be utilized to improve the taste, texture, and shelf-life of various food products.
Used in Cosmetic Industry:
Methylidopyranosiduronic acid can be used as a cosmetic ingredient in the development of new skincare and beauty products. Its unique properties and reactivity can be harnessed to improve the efficacy and performance of various cosmetic formulations, such as moisturizers, anti-aging creams, and sunscreens.
Check Digit Verification of cas no
The CAS Registry Mumber 134355-31-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,3,5 and 5 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 134355-31:
(8*1)+(7*3)+(6*4)+(5*3)+(4*5)+(3*5)+(2*3)+(1*1)=110
110 % 10 = 0
So 134355-31-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O7.Na/c1-13-7-4(10)2(8)3(9)5(14-7)6(11)12;/h2-5,7-10H,1H3,(H,11,12);/q;+1/p-1/t2-,3-,4+,5+,7+;/m0./s1
