134448-22-9 Usage
Description
3-(PYRROL-3-YL)-PROPIONIC ACID, with the molecular formula C8H9NO2, is an organic acid that features a pyrrole ring with a propionic acid functional group attached. 3-(PYRROL-3-YL)-PROPIONIC ACID is known for its unique structural attributes, exhibiting both acidic and aromatic properties. Its pyrrole moiety is recognized for its potential biological and pharmaceutical activities, including antimicrobial, antitumor, and anti-inflammatory effects. The propionic acid group enhances its chemical reactivity, making 3-(PYRROL-3-YL)-PROPIONIC ACID a versatile building block in the synthesis of complex organic molecules and a valuable intermediate in pharmaceutical research and chemical synthesis.
Uses
Used in Pharmaceutical Research:
3-(PYRROL-3-YL)-PROPIONIC ACID is used as a key intermediate for the synthesis of pharmaceutical compounds due to its potential biological activities, such as antimicrobial, antitumor, and anti-inflammatory properties.
Used in Organic Synthesis:
3-(PYRROL-3-YL)-PROPIONIC ACID is used as a versatile building block for the creation of various organic compounds, leveraging its acidic and aromatic properties to form complex molecular structures.
Used in Chemical Synthesis Industry:
3-(PYRROL-3-YL)-PROPIONIC ACID is used as a valuable intermediate for the synthesis of complex organic molecules, contributing to the development of new chemical entities with potential applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 134448-22-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,4,4 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 134448-22:
(8*1)+(7*3)+(6*4)+(5*4)+(4*4)+(3*8)+(2*2)+(1*2)=119
119 % 10 = 9
So 134448-22-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2/c9-7(10)2-1-6-3-4-8-5-6/h3-5,8H,1-2H2,(H,9,10)
