134616-73-2 Usage
General Description
(3-Cyano-4-methyl-6-oxo-1,6-dihydropyridin-2-yl) thio]acetic acid is a complex chemical compound with the molecular formula C9H8N2O3S. It is a heterocyclic organic compound that contains a pyridine ring with a cyano and a methyl group. This chemical is commonly utilized in pharmaceutical research and drug development due to its potential biological activities. It has been investigated for its potential anti-inflammatory, antimicrobial, and antifungal properties. The compound's ability to form strong hydrogen bonds and its lipophilic character contribute to its potential pharmacological activities. Additionally, it has been explored for its potential use in the synthesis of other chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 134616-73-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,6,1 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 134616-73:
(8*1)+(7*3)+(6*4)+(5*6)+(4*1)+(3*6)+(2*7)+(1*3)=122
122 % 10 = 2
So 134616-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O3S/c1-5-2-7(12)11-9(6(5)3-10)15-4-8(13)14/h2H,4H2,1H3,(H,11,12)(H,13,14)/p-1
