134640-85-0 Usage
General Description
2,3-Dimethylphenylmagnesium bromide is a chemical compound that belongs to the class of organometallic compounds. It is commonly used as a reagent in organic synthesis, where it acts as a nucleophile in various reactions such as Grignard reactions and the formation of carbon-carbon bonds. 2,3-Dimethylphenylmagnesium bromide is known for its ability to add to a wide range of electrophiles, making it a versatile and useful tool in the field of organic chemistry. Its reactivity and versatility have made it a valuable component in the development of complex organic molecules and pharmaceutical compounds. Additionally, it is often utilized in the production of polymers and other specialty chemicals, making it an important substance in various industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 134640-85-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,6,4 and 0 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 134640-85:
(8*1)+(7*3)+(6*4)+(5*6)+(4*4)+(3*0)+(2*8)+(1*5)=120
120 % 10 = 0
So 134640-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9.BrH.Mg/c1-7-5-3-4-6-8(7)2;;/h3-5H,1-2H3;1H;/q-1;;+2/p-1
