13475-75-7 Usage
Properties
1. Chemical class: Alkanes
2. Molecular formula: C23H48
3. Carbon chain: 23 carbon atoms
4. Hydrogen atoms: 48 hydrogen atoms
5. Natural sources: Petroleum
6. Industrial applications: Lubricants, solvents, plastics, polymers
7. Uses: Personal care products, cosmetics
8. Stability: High chemical stability and resistance to heat
Specific content
23 carbon atoms
48 hydrogen atoms
Found in petroleum
Used in lubricants, solvents, plastics, polymers, personal care products, and cosmetics
High chemical stability and heat resistance
Check Digit Verification of cas no
The CAS Registry Mumber 13475-75-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,4,7 and 5 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13475-75:
(7*1)+(6*3)+(5*4)+(4*7)+(3*5)+(2*7)+(1*5)=107
107 % 10 = 7
So 13475-75-7 is a valid CAS Registry Number.
InChI:InChI=1/C21H44/c1-4-7-10-13-16-19-21(18-15-12-9-6-3)20-17-14-11-8-5-2/h21H,4-20H2,1-3H3
