13482-78-5 Usage
Description
(2E)-3-(1-BENZYL-1H-1,2,3-TRIAZOL-4-YL)ACRYLALDEHYDE is a chemical compound belonging to the triazole family, with a molecular formula of C12H10N2O. It features a benzyl group and an aldehyde functional group, which contribute to its unique structure and reactivity. (2E)-3-(1-BENZYL-1H-1,2,3-TRIAZOL-4-YL)ACRYLALDEHYDE serves as a valuable building block in organic synthesis and medicinal chemistry research, facilitating the development of novel drug candidates and biologically active compounds.
Uses
Used in Organic Synthesis:
(2E)-3-(1-BENZYL-1H-1,2,3-TRIAZOL-4-YL)ACRYLALDEHYDE is used as a building block in organic synthesis for its unique structure and reactivity, enabling the creation of a variety of novel compounds.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, (2E)-3-(1-BENZYL-1H-1,2,3-TRIAZOL-4-YL)ACRYLALDEHYDE is utilized as a key component in the development of new drug candidates, thanks to its distinctive properties and potential for chemical modification.
Used in Materials Science:
(2E)-3-(1-BENZYL-1H-1,2,3-TRIAZOL-4-YL)ACRYLALDEHYDE has potential applications in materials science, particularly in the development of functional polymers and coatings, where its chemical properties can be harnessed to create innovative materials with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 13482-78-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,4,8 and 2 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 13482-78:
(7*1)+(6*3)+(5*4)+(4*8)+(3*2)+(2*7)+(1*8)=105
105 % 10 = 5
So 13482-78-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11N3O/c16-8-4-7-12-10-15(14-13-12)9-11-5-2-1-3-6-11/h1-8,10H,9H2/b7-4+