134826-36-1 Usage
General Description
2-(2-methylacridin-9-yl)sulfanyl-1-phenyl-ethanone is a chemical compound consisting of an acridine derivative with a sulfur atom attached to a phenyl-ethanone group. The acridine moiety is a polycyclic aromatic hydrocarbon with potential biological activities, including anti-tumor and anti-microbial properties. The presence of the sulfur atom in the molecule suggests potential reactivity and the ability to form covalent bonds with other molecules. The phenyl-ethanone group, on the other hand, is a common organic functional group that can be found in various natural and synthetic compounds. Overall, this chemical compound may have potential applications in medicinal chemistry and materials science due to its unique structure and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 134826-36-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,8,2 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 134826-36:
(8*1)+(7*3)+(6*4)+(5*8)+(4*2)+(3*6)+(2*3)+(1*6)=131
131 % 10 = 1
So 134826-36-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H17NOS/c1-15-11-12-20-18(13-15)22(17-9-5-6-10-19(17)23-20)25-14-21(24)16-7-3-2-4-8-16/h2-13H,14H2,1H3