134855-89-3 Usage
Uses
Used in Pharmaceutical Industry:
(R)-4-(1-Aminoethyl)phenol (S)-hydroxybutanedioate salt is used as a pharmaceutical intermediate for the production of various drugs. Its chiral nature and pharmacological properties make it a valuable component in the synthesis of pharmaceutical products, contributing to the development of new and effective medications.
Used in Drug Synthesis:
(R)-4-(1-Aminoethyl)phenol (S)-hydroxybutanedioate salt is used as a key component in the synthesis of pharmaceutical products. Its unique chemical structure and properties allow it to be incorporated into the development of new drugs, potentially leading to innovative treatments and therapies.
Used in Chiral Chemistry:
(R)-4-(1-Aminoethyl)phenol (S)-hydroxybutanedioate salt is used as a chiral compound in the field of chiral chemistry. Its enantiomeric purity and unique spatial arrangement make it a valuable tool for studying the effects of chirality on chemical reactions and biological activity, furthering our understanding of stereochemistry and its implications in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 134855-89-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,8,5 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 134855-89:
(8*1)+(7*3)+(6*4)+(5*8)+(4*5)+(3*5)+(2*8)+(1*9)=153
153 % 10 = 3
So 134855-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO/c1-6(9)7-2-4-8(10)5-3-7/h2-6,10H,9H2,1H3/t6-/m0/s1
134855-89-3Relevant academic research and scientific papers
Amino acid derivatives having anti-tumor activity and compositions containing them
-
, (2008/06/13)
Amino acid amides of formula (I): STR1 wherein R1 -R5 and Y represent a variety of organic groups and atoms (including where R2, Y and the adjacent nitrogen atom together represent a thiazolidine or pyrrolidine group) and X represents carbonyl or sulfonyl are mostly new compounds and have valuable anti-tumor and immuno-regulatory activities. They may be formulated in compositions for pharmaceutical use.
