1352743-83-9 Usage
General Description
1-(4,6-dibromo-3-fluorothieno[3,4-b]thiophen-2-yl)-2-ethylhexan-1-one is a chemical compound with a complex molecular structure. Its chemical name indicates that it contains bromine, fluorine, thieno, and hexanone functional groups. The presence of these chemical groups suggests that it may have potential applications in pharmaceuticals, agrochemicals, or materials science. However, further research is necessary to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 1352743-83-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,3,5,2,7,4 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1352743-83:
(9*1)+(8*3)+(7*5)+(6*2)+(5*7)+(4*4)+(3*3)+(2*8)+(1*3)=159
159 % 10 = 9
So 1352743-83-9 is a valid CAS Registry Number.
InChI:1/C14H15Br2FOS2/c1-3-5-6-7(4-2)10(18)12-9(17)8-11(19-12)14(16)20-13(8)15/h7H,3-6H2,1-2H3