135322-16-6 Usage
General Description
1-(Aminoiminomethyl)-4-piperidinecarboxylic acid, also known as carbazeran, is a chemical compound with the molecular formula C9H16N2O2. It is a piperidine derivative and is commonly used as an intermediate in the synthesis of pharmaceutical drugs. 1-(Aminoiminomethyl)-4-piperidinecarboxylic acid contains an amino group and a carboxylic acid group, making it potentially useful in organic synthesis and drug design. Its molecular structure suggests that it may have bioactive properties and could be involved in interactions with biological systems, making it of interest in pharmaceutical research. Overall, 1-(Aminoiminomethyl)-4-piperidinecarboxylic acid has potential applications in drug development and medicinal chemistry due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 135322-16-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,3,2 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 135322-16:
(8*1)+(7*3)+(6*5)+(5*3)+(4*2)+(3*2)+(2*1)+(1*6)=96
96 % 10 = 6
So 135322-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3O2/c8-7(9)10-3-1-5(2-4-10)6(11)12/h5H,1-4H2,(H3,8,9)(H,11,12)