135380-30-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Methyl-2,6-diazaspiro[3.4]octane is used as a key component in the development of drugs for various diseases, including cancer, infectious diseases, and neurological disorders. Its unique structure and properties contribute to the therapeutic efficacy of these medications.
Used in Organic Synthesis:
As a solvent, 2-Methyl-2,6-diazaspiro[3.4]octane is employed in various organic synthesis processes, facilitating the formation of desired products and improving the efficiency of chemical reactions.
Used in Manufacturing of Dyes and Surfactants:
2-Methyl-2,6-diazaspiro[3.4]octane is utilized as an intermediate in the production of dyes and surfactants, contributing to the color and functional properties of these chemicals.
Used in Oil and Gas Production:
As a corrosion inhibitor, 2-Methyl-2,6-diazaspiro[3.4]octane plays a crucial role in oil and gas production, protecting equipment from corrosion and extending their operational lifespan.
Used in Production of Antifreeze and Heat Transfer Fluids:
2-Methyl-2,6-diazaspiro[3.4]octane is incorporated into the formulation of antifreeze and heat transfer fluids, enhancing their performance and ensuring the efficient operation of various industrial systems.
Check Digit Verification of cas no
The CAS Registry Mumber 135380-30-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,3,8 and 0 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 135380-30:
(8*1)+(7*3)+(6*5)+(5*3)+(4*8)+(3*0)+(2*3)+(1*0)=112
112 % 10 = 2
So 135380-30-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2/c1-9-5-7(6-9)2-3-8-4-7/h8H,2-6H2,1H3
