135380-51-7 Usage
Uses
Used in Medicinal Chemistry:
7-Benzyl-2-methyl-2,7-diazaspiro[3.5]nonane is utilized as a key component in the development of novel pharmaceutical compounds due to its unique spirocyclic structure and heterocyclic nature. Its potential applications in medicinal chemistry include the synthesis of new drugs and the enhancement of existing ones by improving their pharmacological properties.
Used in Drug Discovery:
In the field of drug discovery, 7-Benzyl-2-methyl-2,7-diazaspiro[3.5]nonane serves as a valuable building block for the creation of innovative therapeutic agents. Its incorporation into drug molecules can lead to the discovery of new drugs with improved efficacy, selectivity, and reduced side effects.
Used in Pharmaceutical Compounds:
7-Benzyl-2-methyl-2,7-diazaspiro[3.5]nonane is employed as a structural element in the design and synthesis of pharmaceutical compounds. Its unique properties can contribute to the development of drugs with enhanced pharmacokinetics, better bioavailability, and targeted delivery to specific tissues or organs.
Check Digit Verification of cas no
The CAS Registry Mumber 135380-51-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,3,8 and 0 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 135380-51:
(8*1)+(7*3)+(6*5)+(5*3)+(4*8)+(3*0)+(2*5)+(1*1)=117
117 % 10 = 7
So 135380-51-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2/c1-2-4-13(5-3-1)10-16-8-6-14(7-9-16)11-15-12-14/h1-5,15H,6-12H2
