13562-81-7 Usage
Uses
Used in Flavor and Fragrance Industry:
Acetoacetic acid 3-pentyl ester is used as a flavoring agent for its fruity odor, enhancing the aroma of various products such as perfumes and food items.
Used in Dye Industry:
ACETOACETIC ACID 3-PENTYL ESTER is utilized as a solvent in the production of dyes, aiding in the process of dye synthesis and application.
Used in Pharmaceutical Industry:
Acetoacetic acid 3-pentyl ester is employed as a solvent and precursor in the synthesis of pharmaceuticals, contributing to the development of new drugs and medicines.
Used in Chemical Synthesis:
As a precursor, it is used in the synthesis of other chemicals, such as pyridines and amino acids, playing a crucial role in the creation of various chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 13562-81-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,5,6 and 2 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13562-81:
(7*1)+(6*3)+(5*5)+(4*6)+(3*2)+(2*8)+(1*1)=97
97 % 10 = 7
So 13562-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H16O3/c1-4-8(5-2)12-9(11)6-7(3)10/h8H,4-6H2,1-3H3
