135748-33-3 Usage
Uses
Used in Pharmaceutical Synthesis:
2,4-Dichloro-5-Fluorobenzamide is used as a building block for the synthesis of various pharmaceuticals, contributing to the development of new drugs due to its unique chemical structure and properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, 2,4-Dichloro-5-Fluorobenzamide serves as a key intermediate in the production of agrochemicals, potentially enhancing crop protection and yield.
Used in Anti-Inflammatory and Pain-Relieving Applications:
2,4-Dichloro-5-Fluorobenzamide is utilized for its anti-inflammatory and pain-relieving properties, making it a candidate for the development of medications aimed at treating inflammation and pain.
Used in Herbicide Development:
2,4-DICHLORO-5-FLUOROBENZAMIDE has been investigated for its potential as a herbicide, suggesting its use in controlling unwanted plant growth in agricultural settings, thereby contributing to more efficient crop cultivation.
Overall, 2,4-Dichloro-5-Fluorobenzamide's versatility positions it as a valuable compound in multiple industries, from healthcare to agriculture, underscoring its importance in research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 135748-33-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,7,4 and 8 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 135748-33:
(8*1)+(7*3)+(6*5)+(5*7)+(4*4)+(3*8)+(2*3)+(1*3)=143
143 % 10 = 3
So 135748-33-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H4Cl2FNO/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,(H2,11,12)
