135906-00-2 Usage
Uses
Used in Pharmaceutical Industry:
1-CYCLOHEXYL-4-OXO-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID is used as a key intermediate in the synthesis of pharmaceuticals for its role in the production of various drugs. Its ability to modulate biological pathways makes it a valuable target for drug development, potentially leading to the creation of new therapeutic agents.
Used in Drug Development:
As a compound with the capacity to influence biological pathways, 1-CYCLOHEXYL-4-OXO-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID is utilized in drug development to explore its potential therapeutic applications. This may include the treatment of various diseases and conditions by modulating specific biological processes.
Used in Materials Science and Organic Chemistry:
Beyond its pharmaceutical applications, 1-CYCLOHEXYL-4-OXO-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID may also find use in materials science and organic chemistry due to its unique structural features and chemical properties, potentially contributing to the advancement of these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 135906-00-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,9,0 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 135906-00:
(8*1)+(7*3)+(6*5)+(5*9)+(4*0)+(3*6)+(2*0)+(1*0)=122
122 % 10 = 2
So 135906-00-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H17NO3/c18-15-12-8-4-5-9-14(12)17(10-13(15)16(19)20)11-6-2-1-3-7-11/h4-5,8-11H,1-3,6-7H2,(H,19,20)
