136-76-5 Usage
General Description
2,5-dibutoxyaniline is a chemical compound that belongs to the family of aniline-derived chemicals, which are commonly used in the production of dyes, pharmaceuticals, and agrochemicals. This specific compound is characterized by the presence of two butoxy groups attached to the aniline ring at the 2 and 5 positions. It is commonly used as an intermediate in the synthesis of various organic compounds and has been found to exhibit antioxidant and antimicrobial properties. Additionally, 2,5-dibutoxyaniline has potential applications in the development of corrosion inhibitors and as a building block in medicinal chemistry. Due to its chemical structure and properties, this compound has attracted attention for its potential in various industrial and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 136-76-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,3 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 136-76:
(5*1)+(4*3)+(3*6)+(2*7)+(1*6)=55
55 % 10 = 5
So 136-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H23NO2/c1-3-5-9-16-12-7-8-14(13(15)11-12)17-10-6-4-2/h7-8,11H,3-6,9-10,15H2,1-2H3
