136099-65-5 Usage
Uses
Used in Organic Synthesis:
5-METHYLBENZOTHIOPHENE-2-BORONIC ACID is used as a reagent for the construction of carbon-carbon and carbon-heteroatom bonds, which is crucial for the synthesis of complex organic molecules.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 5-METHYLBENZOTHIOPHENE-2-BORONIC ACID is used as a key intermediate in the synthesis of various drugs, contributing to the development of new medicinal compounds.
Used in Agrochemical Development:
5-METHYLBENZOTHIOPHENE-2-BORONIC ACID is utilized as a building block in the creation of agrochemicals, potentially leading to the development of new pesticides or other agricultural products.
Used in Materials Science:
In the field of materials science, 5-METHYLBENZOTHIOPHENE-2-BORONIC ACID is employed for the synthesis of novel materials with specific properties, such as those with unique electronic or optical characteristics.
Used in Medicinal Chemistry Research:
5-METHYLBENZOTHIOPHENE-2-BORONIC ACID is used as a subject of study for its potential biological activities, which could lead to the discovery of new therapeutic agents or contribute to a better understanding of molecular interactions in biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 136099-65-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,0,9 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 136099-65:
(8*1)+(7*3)+(6*6)+(5*0)+(4*9)+(3*9)+(2*6)+(1*5)=145
145 % 10 = 5
So 136099-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BO2S/c1-6-2-3-8-7(4-6)5-9(13-8)10(11)12/h2-5,11-12H,1H3
Harmful:;
