136099-65-5 Usage
General Description
5-METHYLBENZOTHIOPHENE-2-BORONIC ACID is a chemical compound consisting of a benzothiophene ring with a boronic acid functional group attached at the 2-position. It is commonly used in organic synthesis as a reagent for the construction of carbon-carbon and carbon-heteroatom bonds. 5-METHYLBENZOTHIOPHENE-2-BORONIC ACID has potential applications in the production of pharmaceuticals, agrochemicals, and materials science. Its unique structure and reactivity make it a valuable building block for the synthesis of various complex organic molecules. Additionally, it has been studied for its potential biological activities and could have relevance in medicinal chemistry research. Overall, 5-METHYLBENZOTHIOPHENE-2-BORONIC ACID is an important chemical with diverse applications in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 136099-65-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,0,9 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 136099-65:
(8*1)+(7*3)+(6*6)+(5*0)+(4*9)+(3*9)+(2*6)+(1*5)=145
145 % 10 = 5
So 136099-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H9BO2S/c1-6-2-3-8-7(4-6)5-9(13-8)10(11)12/h2-5,11-12H,1H3
Harmful:;
