13615-46-8 Usage
Uses
Used in Biochemical Research:
TRANS-INDOLE-3-ACRYLIC ACID SODIUM SALT is used as a research compound for studying various biological processes and mechanisms. Its unique chemical structure allows it to interact with specific proteins and enzymes, providing valuable insights into their functions and potential therapeutic applications.
Used in Pharmaceutical Production:
As a synthetic intermediate, TRANS-INDOLE-3-ACRYLIC ACID SODIUM SALT is used in the production of various pharmaceuticals and organic compounds. Its versatile chemical properties enable the synthesis of a wide range of therapeutic agents, including those targeting cancer, inflammation, and neurological disorders.
Used in Organic Synthesis and Chemical Reactions:
TRANS-INDOLE-3-ACRYLIC ACID SODIUM SALT is employed as a reagent in organic synthesis and chemical reactions. Its ability to participate in various chemical transformations makes it an essential component in the synthesis of complex organic molecules and the development of new chemical processes.
Used in Therapeutic Applications:
TRANS-INDOLE-3-ACRYLIC ACID SODIUM SALT has been studied for its potential therapeutic applications in the treatment of various diseases. Its unique chemical properties and interactions with biological targets make it a promising candidate for the development of new drugs and therapies.
Used in Cancer Treatment:
TRANS-INDOLE-3-ACRYLIC ACID SODIUM SALT is being investigated for its potential as an anticancer agent. Its ability to modulate various signaling pathways and interact with specific proteins involved in cancer progression makes it a promising candidate for the development of new cancer therapies.
Used in Inflammation Management:
Due to its potential anti-inflammatory properties, TRANS-INDOLE-3-ACRYLIC ACID SODIUM SALT is being studied for its use in managing inflammation-related conditions. Its ability to modulate inflammatory pathways and reduce the production of pro-inflammatory mediators makes it a potential therapeutic agent for treating inflammatory diseases.
Used in Neurological Disorders Treatment:
TRANS-INDOLE-3-ACRYLIC ACID SODIUM SALT is also being explored for its potential applications in the treatment of neurological disorders. Its interactions with specific neurotransmitter systems and neuroprotective properties make it a promising candidate for the development of new therapies for neurological conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 13615-46-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,1 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 13615-46:
(7*1)+(6*3)+(5*6)+(4*1)+(3*5)+(2*4)+(1*6)=88
88 % 10 = 8
So 13615-46-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO2.Na/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10;/h1-7,12H,(H,13,14);/q;+1/p-1/b6-5+;
