13630-00-7 Usage
Uses
Used in Pharmaceutical Research and Development:
(1R,2S)-(+)-cis-1-Amino-2-indanol is utilized as a chiral building block for the synthesis of pharmaceuticals, where its enantioselective properties are crucial for the development of drugs with specific biological activities. (1R,2S)-(+)-cis-1-Amino-2-indanol's ability to form enantioselective products ensures that the resulting pharmaceuticals have the desired efficacy and reduced side effects.
Used in Agrochemical Synthesis:
In the agrochemical industry, (1R,2S)-(+)-cis-1-Amino-2-indanol is employed as a chiral building block for the creation of agrochemicals with targeted pest control properties. Its enantioselective synthesis capabilities allow for the development of more effective and environmentally friendly pesticides.
Used in Fine Chemicals Production:
(1R,2S)-(+)-cis-1-Amino-2-indanol is also used in the production of fine chemicals, where its chiral nature is leveraged to create high-quality specialty chemicals with specific applications in various industries, such as fragrances, flavors, and cosmetics.
Used in Asymmetric Catalysis:
(1R,2S)-(+)-cis-1-Amino-2-indanol has demonstrated potential as a ligand in asymmetric catalysis. Its application in this field is significant for enhancing the efficiency and selectivity of chemical reactions, leading to the production of enantiomerically pure compounds, which are essential in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 13630-00-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,3 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 13630-00:
(7*1)+(6*3)+(5*6)+(4*3)+(3*0)+(2*0)+(1*0)=67
67 % 10 = 7
So 13630-00-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/p+1/t8-,9+/m0/s1
Xn:Harmful;
