136411-57-9 Usage
Uses
Used in Medicinal Chemistry:
Pyrido[4,3-c]pyridazin-5(6H)-one (9CI) is used as a potential candidate in medicinal chemistry for its unique structure and potential biological activities. Its heterocyclic nature and the presence of a carbonyl group at the 5th position may contribute to its interaction with biological targets, making it a promising compound for the development of new drugs.
Used in Drug Discovery:
In the field of drug discovery, Pyrido[4,3-c]pyridazin-5(6H)-one (9CI) is utilized as a starting point for the design and synthesis of novel therapeutic agents. Its unique structural features may provide a foundation for the development of compounds with specific biological activities, targeting various diseases and conditions.
Used in Organic Synthesis:
Pyrido[4,3-c]pyridazin-5(6H)-one (9CI) is used as a building block in the synthesis of other organic compounds. Its heterocyclic structure and functional groups can be further modified or combined with other chemical entities to create new molecules with desired properties and applications in various industries, including pharmaceuticals, materials science, and agrochemicals.
Further research is needed to explore the full range of properties and potential applications of Pyrido[4,3-c]pyridazin-5(6H)-one (9CI), as its unique structure and potential biological activities may lead to the discovery of new therapeutic agents and innovative applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 136411-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,4,1 and 1 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 136411-57:
(8*1)+(7*3)+(6*6)+(5*4)+(4*1)+(3*1)+(2*5)+(1*7)=109
109 % 10 = 9
So 136411-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H5N3O/c11-7-5-1-4-9-10-6(5)2-3-8-7/h1-4H,(H,8,11)
136411-57-9Relevant academic research and scientific papers
A Novel Approach to the Pyridopyridazine Ring. Synthesis of Pyridopyridazin-5(6H)-one from 3,4-Disubstituted Pyridazines
Vors, Jean-Pierre
, p. 1043 - 1046 (2007/10/02)
The synthesis of new pyridopyridazin-5(6H)-one from ethyl 3-methyl-4-pyridazinecarboxylate using an enamination/ring closure sequence is described.The starting material is easily available from a hetero Diels-Alder reaction between a 1,2-diaza-1,3-
