136559-37-0 Usage
General Description
2,6-DIMETHOXY-3,7-BIS(METHYLSELENO)-NAPHTHALENE is a chemical compound that belongs to the class of methoxy-substituted naphthalenes. It is known for its unique molecular structure, which includes two methoxy groups and two methylseleno groups attached to a naphthalene backbone. 2,6-DIMETHOXY-3,7-BIS(METHYLSELENO)-NAPHTHALENE has been studied for its potential biological and medicinal properties, including its antioxidant and anti-inflammatory effects. Additionally, its structural features make it a valuable tool for understanding the reactivity and properties of organic compounds containing selenium. Overall, 2,6-DIMETHOXY-3,7-BIS(METHYLSELENO)-NAPHTHALENE is a complex and intriguing chemical with potential applications in various fields of research and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 136559-37-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,5,5 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 136559-37:
(8*1)+(7*3)+(6*6)+(5*5)+(4*5)+(3*9)+(2*3)+(1*7)=150
150 % 10 = 0
So 136559-37-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H16O2Se2/c1-15-11-5-9-8-14(18-4)12(16-2)6-10(9)7-13(11)17-3/h5-8H,1-4H3
