13657-24-4 Usage
Uses
Used in Pharmaceutical Industry:
1-(3,3-diphenylpropyl)hexahydro-1H-azepinium chloride is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure and cationic nature contribute to its effectiveness in this application.
Used in Chemical Processes:
In the chemical industry, 1-(3,3-diphenylpropyl)hexahydro-1H-azepinium chloride serves as a chiral resolving agent. Its ability to selectively interact with other molecules due to its chiral properties makes it valuable in various chemical processes, particularly in the synthesis of enantiomerically pure compounds.
Used in Drug Delivery Systems:
Although not explicitly mentioned in the provided materials, given its cationic nature and potential for interaction with biopolymers and macromolecules, 1-(3,3-diphenylpropyl)hexahydro-1H-azepinium chloride could also be explored for use in drug delivery systems. This application would involve its use as a carrier or enhancer for the delivery of therapeutic agents, potentially improving their bioavailability and targeting specific tissues or cells.
Check Digit Verification of cas no
The CAS Registry Mumber 13657-24-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,5 and 7 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 13657-24:
(7*1)+(6*3)+(5*6)+(4*5)+(3*7)+(2*2)+(1*4)=104
104 % 10 = 4
So 13657-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H27N.ClH/c1-2-10-17-22(16-9-1)18-15-21(19-11-5-3-6-12-19)20-13-7-4-8-14-20;/h3-8,11-14,21H,1-2,9-10,15-18H2;1H
