13657-24-4 Usage
General Description
1-(3,3-diphenylpropyl)hexahydro-1H-azepinium chloride is a chemical compound that belongs to the class of quaternary ammonium compounds. It is commonly used as a pharmaceutical intermediate and is also known for its use as a chiral resolving agent in various chemical processes. It has a cationic nature due to its quaternary ammonium group, and the chloride ion serves as the counterion. 1-(3,3-diphenylpropyl)hexahydro-1H-azepinium chloride has a unique structure with a bulky diphenylpropyl group attached to a hexahydro-1H-azepinium core, which gives it specific properties and makes it suitable for various applications in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 13657-24-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,5 and 7 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 13657-24:
(7*1)+(6*3)+(5*6)+(4*5)+(3*7)+(2*2)+(1*4)=104
104 % 10 = 4
So 13657-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C21H27N.ClH/c1-2-10-17-22(16-9-1)18-15-21(19-11-5-3-6-12-19)20-13-7-4-8-14-20;/h3-8,11-14,21H,1-2,9-10,15-18H2;1H
