13663-07-5 Usage
Uses
Used in Organic Synthesis:
2-(4-Chloro Phenylthio)-Triethylamine Hcl is used as a reagent in organic synthesis for its ability to facilitate various chemical reactions. Its unique structure allows it to participate in a range of reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Chemical Reactions:
In the chemical reactions industry, 2-(4-Chloro Phenylthio)-Triethylamine Hcl is employed as a reagent to catalyze or mediate specific transformations. Its presence can enhance reaction rates, selectivity, or yield, contributing to the efficiency and effectiveness of chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 13663-07-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,6,6 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 13663-07:
(7*1)+(6*3)+(5*6)+(4*6)+(3*3)+(2*0)+(1*7)=95
95 % 10 = 5
So 13663-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H18ClNS/c1-3-14(4-2)9-10-15-12-7-5-11(13)6-8-12/h5-8H,3-4,9-10H2,1-2H3
