136790-70-0 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-2-fluoroaniline hydrobromide is used as an intermediate compound for the synthesis of various pharmaceutical drugs. Its unique structure allows for the creation of new drug molecules with potential therapeutic applications.
Used in Agrochemical Industry:
4-Bromo-2-fluoroaniline hydrobromide is used as a building block in the development of agrochemicals, such as pesticides and herbicides. Its chemical properties enable the production of effective compounds for agricultural use.
Used in Dye and Pigment Industry:
4-Bromo-2-fluoroaniline hydrobromide is used as a starting material for the synthesis of dyes and pigments. Its presence in the molecular structure can contribute to the color and stability of these products.
Used in Chemical Research:
4-Bromo-2-fluoroaniline hydrobromide is used as a research compound in various chemical studies. Its unique properties make it a valuable tool for understanding chemical reactions and exploring new synthetic pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 136790-70-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,7,9 and 0 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 136790-70:
(8*1)+(7*3)+(6*6)+(5*7)+(4*9)+(3*0)+(2*7)+(1*0)=150
150 % 10 = 0
So 136790-70-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrFN.BrH/c7-4-1-2-6(9)5(8)3-4;/h1-3H,9H2;1H
136790-70-0Relevant academic research and scientific papers
Preparation of 3-halo-halobenzenes and 1-halo-3,5-dihalobenzenes
-
, (2008/06/13)
In a process for producing a 3-halo-halobenzene or a 1-halo-3,5-dihalobenzene, a 2-halo-4-haloaniline or 2-halo-4,6-dihaloaniline is mixed with a deaminating agent. The 2-halo-4-haloaniline or 2-halo-4,6-dihaloaniline is deaminated so as to form a corresponding 3-halo-halobenzene or 1-halo-3,5-dihalobenzene.
