136805-54-4 Usage
Uses
Used in Organic Synthesis:
PYRIDINE-2-BORONIC ACID DIMETHYL ESTER is used as a reagent in Suzuki-Miyaura coupling reactions, which are cross-coupling processes that facilitate the formation of carbon-carbon bonds. This application is crucial for the synthesis of complex organic molecules, including those with pharmaceutical relevance.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, PYRIDINE-2-BORONIC ACID DIMETHYL ESTER is utilized for the synthesis of various pharmaceutical compounds. Its ability to form stable intermediates in cross-coupling reactions makes it a valuable tool in the development of new drugs and biologically active molecules.
Used in Material Science:
PYRIDINE-2-BORONIC ACID DIMETHYL ESTER is also studied for its potential applications in material science. Its properties are being explored for the development of new materials and catalysts, which could have wide-ranging applications across different industries.
Used in Catalyst Development:
PYRIDINE-2-BORONIC ACID DIMETHYL ESTER's potential in the development of catalysts is another area of interest. Catalysts are essential in various chemical processes, and the unique properties of PYRIDINE-2-BORONIC ACID DIMETHYL ESTER could contribute to the creation of more efficient and selective catalysts for industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 136805-54-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,8,0 and 5 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 136805-54:
(8*1)+(7*3)+(6*6)+(5*8)+(4*0)+(3*5)+(2*5)+(1*4)=134
134 % 10 = 4
So 136805-54-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H10BNO2/c1-10-8(11-2)7-5-3-4-6-9-7/h3-6H,1-2H3
