136888-08-9 Usage
General Description
5-Chloro-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one is a chemical compound with the molecular formula C9H6ClNO. It is a heterocyclic compound with a pyrrolopyridine core structure and a chlorine atom attached to the 5th carbon. 5-CHLORO-1,3-DIHYDRO-2H-PYRROLO[3,2-B] PYRIDIN-2-ONE has potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block for the synthesis of various biologically active compounds. It is also known for its anti-inflammatory and anti-bacterial properties and is used in research for the development of new drugs. Additionally, its unique structure and reactivity make it a valuable intermediate in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 136888-08-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,6,8,8 and 8 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 136888-08:
(8*1)+(7*3)+(6*6)+(5*8)+(4*8)+(3*8)+(2*0)+(1*8)=169
169 % 10 = 9
So 136888-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2O/c8-6-2-1-4-5(9-6)3-7(11)10-4/h1-2H,3H2,(H,10,11)