13733-91-0 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2-ANILINO-4,6-DIMERCAPTO-1,3,5-TRIAZINE is utilized as a building block in the synthesis of pharmaceuticals and agrochemicals, facilitating various chemical reactions that contribute to the development of new drugs and pesticides.
Used as an Antioxidant:
2-ANILINO-4,6-DIMERCAPTO-1,3,5-TRIAZINE is employed as an antioxidant, leveraging its chemical structure to protect against oxidative damage, which is crucial in various industrial processes and for maintaining the stability of certain products.
Used as a Complexing Agent in Analytical Chemistry:
In the field of analytical chemistry, 2-ANILINO-4,6-DIMERCAPTO-1,3,5-TRIAZINE serves as a complexing agent, enabling the analysis and detection of metal ions through the formation of stable complexes, which is vital for accurate measurements and assessments.
Used in Heavy Metal Poisoning Treatment:
2-ANILINO-4,6-DIMERCAPTO-1,3,5-TRIAZINE has been studied for its potential use in the treatment of heavy metal poisoning. Its ability to chelate metal ions makes it a promising candidate for therapeutic interventions, particularly in cases where heavy metal exposure poses a significant health risk.
Check Digit Verification of cas no
The CAS Registry Mumber 13733-91-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,3 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13733-91:
(7*1)+(6*3)+(5*7)+(4*3)+(3*3)+(2*9)+(1*1)=100
100 % 10 = 0
So 13733-91-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N4S2/c14-8-11-7(12-9(15)13-8)10-6-4-2-1-3-5-6/h1-5H,(H3,10,11,12,13,14,15)
