137372-00-0 Usage
General Description
AC-THR-LEU-ASN-PHE-OH is a peptide composed of the amino acids threonine (Thr), leucine (Leu), asparagine (Asn), and phenylalanine (Phe), with an amidated carboxylic acid group at the C-terminus. This peptide has the potential to exhibit various biological activities, as the specific sequence and arrangement of amino acids can influence its function. Each amino acid in the sequence contributes specific chemical and structural properties that can contribute to the overall activity of the peptide. The presence of threonine provides potential for phosphorylation, leucine contributes to hydrophobic interactions, asparagine is involved in hydrogen bonding, and phenylalanine can participate in aromatic interactions. The specific sequence of AC-THR-LEU-ASN-PHE-OH could potentially lead to its involvement in enzymatic processes, hormone regulation, or as a therapeutic agent in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 137372-00-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,3,7 and 2 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 137372-00:
(8*1)+(7*3)+(6*7)+(5*3)+(4*7)+(3*2)+(2*0)+(1*0)=120
120 % 10 = 0
So 137372-00-0 is a valid CAS Registry Number.
InChI:InChI=1/C25H37N5O8/c1-13(2)10-17(29-24(36)21(14(3)31)27-15(4)32)22(34)28-18(12-20(26)33)23(35)30-19(25(37)38)11-16-8-6-5-7-9-16/h5-9,13-14,17-19,21,31H,10-12H2,1-4H3,(H2,26,33)(H,27,32)(H,28,34)(H,29,36)(H,30,35)(H,37,38)/t14-,17+,18+,19+,21+/m1/s1