137397-56-9 Usage
General Description
The chemical compound "(7-ethenyl-12-(1-hydroxy-5,9,13-trimethyl-4,8,12-tetradecatrienyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoato(4-)-N21,N22,N23,N24)-Ferrate(2-)" is a complex molecule with a porphyrin structure and a ferrate ion. It contains a tetrapyrrole ring system with a central iron atom and two propionate groups attached to the porphyrin core. The molecule also has a hydroxy group and a long isoprenoid side chain attached to the porphyrin ring. The presence of the ferrate ion indicates that the iron atom is in the +2 oxidation state. This complex compound may have potential applications in fields such as medicine, catalysis, and materials science due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 137397-56-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,3,9 and 7 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 137397-56:
(8*1)+(7*3)+(6*7)+(5*3)+(4*9)+(3*7)+(2*5)+(1*6)=159
159 % 10 = 9
So 137397-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C49H60N4O5.Fe/c1-10-35-31(6)40-26-45-49(46(54)19-13-18-30(5)17-12-16-29(4)15-11-14-28(2)3)34(9)41(53-45)24-38-32(7)36(20-22-47(55)56)43(51-38)27-44-37(21-23-48(57)58)33(8)39(52-44)25-42(35)50-40;/h10,14,16,18,24-27,46,54H,1,11-13,15,17,19-23H2,2-9H3,(H4,50,51,52,53,55,56,57,58);/q;+2/p-2/b29-16+,30-18+,38-24-,39-25-,40-26-,41-24-,42-25-,43-27-,44-27-,45-26-;