13745-17-0 Usage
General Description
4-Bromo-1H-pyrazole-3-carboxylic acid is a chemical compound with the molecular formula C5H4BrN3O2. It is a synthetic chemical used in various research and industrial applications. 4-BROMO-1H-PYRAZOLE-3-CARBOXYLIC ACID is a derivative of pyrazole and contains a carboxylic acid functional group and a bromine atom. It is commonly used as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its unique structure and reactivity make it a valuable tool in the field of organic chemistry for creating new molecules and studying chemical reactions. Additionally, this compound may have potential applications in the development of new drugs and agrochemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 13745-17-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,4 and 5 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 13745-17:
(7*1)+(6*3)+(5*7)+(4*4)+(3*5)+(2*1)+(1*7)=100
100 % 10 = 0
So 13745-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrN2O2/c1-10-5(9)4-3(6)2-7-8-4/h2H,1H3,(H,7,8)
