13745-17-0 Usage
Uses
Used in Pharmaceutical Industry:
4-BROMO-1H-PYRAZOLE-3-CARBOXYLIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form new molecules with potential therapeutic properties. Its unique structure allows for the development of drugs targeting specific biological pathways and mechanisms.
Used in Agrochemical Industry:
In the agrochemical industry, 4-BROMO-1H-PYRAZOLE-3-CARBOXYLIC ACID is used as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its reactivity and functional groups enable the creation of compounds with specific pesticidal or herbicidal activities, contributing to more effective and targeted crop protection.
Used in Organic Chemistry Research:
4-BROMO-1H-PYRAZOLE-3-CARBOXYLIC ACID serves as a valuable tool in organic chemistry research for its potential to create new molecules and study chemical reactions. Its unique structure and reactivity allow researchers to explore novel synthetic pathways and investigate the properties of newly synthesized compounds, furthering the understanding of organic chemistry and its applications.
Used in Drug Development:
4-BROMO-1H-PYRAZOLE-3-CARBOXYLIC ACID is utilized in drug development as a building block for the creation of new drug candidates. Its incorporation into molecular structures can lead to the discovery of compounds with improved pharmacological properties, such as enhanced potency, selectivity, and reduced side effects, ultimately contributing to the development of more effective treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 13745-17-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,4 and 5 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 13745-17:
(7*1)+(6*3)+(5*7)+(4*4)+(3*5)+(2*1)+(1*7)=100
100 % 10 = 0
So 13745-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrN2O2/c1-10-5(9)4-3(6)2-7-8-4/h2H,1H3,(H,7,8)
