13752-33-5 Usage
Description
Panidazole, a nitroimidazole derivative, is an antimicrobial agent that effectively treats various infections caused by anaerobic bacteria and protozoa. It functions by inhibiting the growth and reproduction of these microorganisms through interference with their DNA synthesis, leading to damage in their genetic material and ultimately the elimination of the infection. Panidazole is well-tolerated and is commonly administered orally or intravenously, depending on the severity of the infection.
Uses
Used in Pharmaceutical Industry:
Panidazole is used as an antimicrobial agent for treating infections caused by anaerobic bacteria and protozoa, such as bacterial vaginosis and trichomoniasis. Its mode of action involves disrupting the DNA synthesis of these microorganisms, causing damage to their genetic material and leading to the elimination of the infection.
Used in Treatment of Infections:
Panidazole is used as an oral or intravenous medication for the treatment of certain infections. Its effectiveness in inhibiting the growth and reproduction of anaerobic bacteria and protozoa makes it a widely used medication in combating these types of infections.
Check Digit Verification of cas no
The CAS Registry Mumber 13752-33-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,5 and 2 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13752-33:
(7*1)+(6*3)+(5*7)+(4*5)+(3*2)+(2*3)+(1*3)=95
95 % 10 = 5
So 13752-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N4O2/c1-9-13-8-11(15(16)17)14(9)7-4-10-2-5-12-6-3-10/h2-3,5-6,8H,4,7H2,1H3
