137581-18-1 Usage
General Description
1,3-Diisopropylimidazolinium tetrafluoroborate is a type of ionic liquid, which are salts that are typically liquid at room temperature. 1 3-DIISOPROPYLIMIDAZOLINIUM TETRAFLUOR& has potential applications in various areas due to its unique properties, such as high thermal stability, high ionic conductivity, and ability to dissolve a variety of compounds. It is generally synthesized through the reaction of specific starting materials, followed by anion exchange. Some potential applications of this compound include its use as an electrolyte in batteries, as a solvent in chemical reactions, and in the synthesis of other materials. Although it has many promising qualities, potential risks associated with the use of this chemical, including toxicity and environmental impact, need to be considered.
Check Digit Verification of cas no
The CAS Registry Mumber 137581-18-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,5,8 and 1 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 137581-18:
(8*1)+(7*3)+(6*7)+(5*5)+(4*8)+(3*1)+(2*1)+(1*8)=141
141 % 10 = 1
So 137581-18-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H19N2.BF4/c1-8(2)10-5-6-11(7-10)9(3)4;2-1(3,4)5/h7-9H,5-6H2,1-4H3;/q+1;-1
