137694-75-8 Usage
Description
NG-MONOMETHYL-D-ARGININE MONOACETATE is a white to off-white powder with unique chemical properties. It is a derivative of the amino acid arginine and is known for its sulfhydryl reactive cleavable characteristics, making it a versatile compound in various applications.
Uses
Used in Pharmaceutical Industry:
NG-MONOMETHYL-D-ARGININE MONOACETATE is used as a sulfhydryl reactive cleavable heterobifunctional cross-linking reagent for the development of novel drug delivery systems. Its ability to form covalent bonds with thiol groups in proteins and peptides allows for the creation of stable and targeted drug conjugates, enhancing the efficacy and bioavailability of therapeutic agents.
Used in Research and Development:
In the field of research and development, NG-MONOMETHYL-D-ARGININE MONOACETATE serves as a valuable tool for studying protein-protein interactions, enzyme activity, and the development of new therapeutic strategies. Its unique chemical properties enable researchers to explore its potential in various biological applications, including the design of novel bioconjugates and the investigation of protein function and structure.
Used in Diagnostic Applications:
NG-MONOMETHYL-D-ARGININE MONOACETATE can be employed in the development of diagnostic tools and assays, particularly in the detection and quantification of specific proteins or enzymes. Its reactivity with sulfhydryl groups allows for the selective labeling and detection of target molecules, contributing to the advancement of diagnostic technologies and the improvement of disease detection and monitoring.
Check Digit Verification of cas no
The CAS Registry Mumber 137694-75-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,6,9 and 4 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 137694-75:
(8*1)+(7*3)+(6*7)+(5*6)+(4*9)+(3*4)+(2*7)+(1*5)=168
168 % 10 = 8
So 137694-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H16N4O2/c1-10-7(9)11-4-2-3-5(8)6(12)13/h5H,2-4,8H2,1H3,(H,12,13)(H3,9,10,11)/p+1/t5-/m1/s1