137718-84-4 Usage
Uses
Used in Pharmaceutical Industry:
3,4-DIBROMO-2-FLUOROPYRIDINE is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure allows for the development of new therapeutic agents with specific pharmacological properties, contributing to the advancement of medicinal chemistry.
Used in Organic Synthesis:
In the field of organic chemistry, 3,4-DIBROMO-2-FLUOROPYRIDINE serves as a key building block for the creation of more complex molecules. Its reactivity and structural features make it a valuable component in the synthesis of various organic compounds, including those with potential applications in materials science, agrochemicals, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 137718-84-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,7,1 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 137718-84:
(8*1)+(7*3)+(6*7)+(5*7)+(4*1)+(3*8)+(2*8)+(1*4)=154
154 % 10 = 4
So 137718-84-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H2Br2FN/c6-3-1-2-9-5(8)4(3)7/h1-2H
