1379014-57-9 Usage
General Description
3,3-difluorocyclopentanecarbonitrile is a chemical compound with the molecular formula C5H4F2N. It is a colorless liquid that is commonly used in organic synthesis, particularly in the pharmaceutical industry. 3,3-difluorocyclopentanecarbonitrile is valued for its ability to participate in a variety of chemical reactions, making it a versatile building block for the synthesis of more complex molecules. The presence of fluorine atoms in its structure also gives it unique properties, such as increased metabolic stability and altered pharmacokinetic behavior, which can be beneficial for drug design. Additionally, 3,3-difluorocyclopentanecarbonitrile is known to exhibit potent biological activity, making it a valuable tool for the development of new medicinal compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 1379014-57-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,3,7,9,0,1 and 4 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1379014-57:
(9*1)+(8*3)+(7*7)+(6*9)+(5*0)+(4*1)+(3*4)+(2*5)+(1*7)=169
169 % 10 = 9
So 1379014-57-9 is a valid CAS Registry Number.
InChI:InChI=1S/C6H7F2N/c7-6(8)2-1-5(3-6)4-9/h5H,1-3H2
