13796-76-4 Usage
Description
7-Quinolinecarboxaldehyde,8-hydroxy-2-methyl-(8CI,9CI), also known as 8-hydroxy-2-methylquinoline-7-carbaldehyde, is a chemical compound with the molecular formula C11H9NO2. It is a derivative of quinoline and belongs to the class of aldehydes. This organic compound has a yellowish appearance, is soluble in organic solvents such as ethanol and acetone, and has a characteristic odor. Additionally, it has been studied for its potential antioxidant and antimicrobial properties, making it a desirable compound for various industrial and research applications.
Uses
Used in Pharmaceutical Industry:
7-Quinolinecarboxaldehyde,8-hydroxy-2-methyl-(8CI,9CI) is used as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 7-Quinolinecarboxaldehyde,8-hydroxy-2-methyl-(8CI,9CI) is used as a precursor in the production of various agrochemicals. Its ability to form stable compounds makes it suitable for use in the development of pesticides and other agricultural chemicals.
Used in Dye Industry:
7-Quinolinecarboxaldehyde,8-hydroxy-2-methyl-(8CI,9CI) is used as a starting material in the synthesis of dyes. Its ability to form colored compounds makes it a valuable component in the production of various dyes used in different industries.
Used in Antioxidant Applications:
Due to its potential antioxidant properties, 7-Quinolinecarboxaldehyde,8-hydroxy-2-methyl-(8CI,9CI) can be used as an antioxidant in various applications, such as in the food industry to prevent oxidation and spoilage of food products, or in the cosmetic industry to protect skin from oxidative stress.
Used in Antimicrobial Applications:
7-Quinolinecarboxaldehyde,8-hydroxy-2-methyl-(8CI,9CI) has been studied for its potential antimicrobial properties, making it a candidate for use in various antimicrobial applications, such as in the development of disinfectants, sanitizers, and preservatives in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 13796-76-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,9 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 13796-76:
(7*1)+(6*3)+(5*7)+(4*9)+(3*6)+(2*7)+(1*6)=134
134 % 10 = 4
So 13796-76-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO2/c1-7-2-3-8-4-5-9(6-13)11(14)10(8)12-7/h2-6,14H,1H3
13796-76-4Relevant articles and documents
Quinoline derivatives, having in particular antiviral properties, preparation and biological applications thereof
-
Page column 10, (2008/06/13)
The invention concerns quinoline derivatives of formula (I) in which: Ra, Rband Rc, identical or different represent one or several substituents, themselves identical or different, in any position on the cycles, this or th
