138030-53-2 Usage
General Description
1-Pyridin-2-ylmethylpiperidine-4-carboxylic acid ethyl ester is a chemical compound with the molecular formula C17H23N2O2. It is an ester derivative of 1-pyridin-2-ylmethylpiperidine-4-carboxylic acid and is commonly used in the pharmaceutical industry for the synthesis of various drugs. 1-PYRIDIN-2-YLMETHYLPIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER possesses a piperidine ring, a pyridine ring, and an ethyl ester functional group, making it a valuable building block for the creation of new pharmaceutical compounds. Its chemical properties and structure make it useful for the development of potential drug candidates and other biological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 138030-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,0,3 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 138030-53:
(8*1)+(7*3)+(6*8)+(5*0)+(4*3)+(3*0)+(2*5)+(1*3)=102
102 % 10 = 2
So 138030-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O2/c1-2-18-14(17)12-6-9-16(10-7-12)11-13-5-3-4-8-15-13/h3-5,8,12H,2,6-7,9-11H2,1H3
