138030-53-2 Usage
Uses
Used in Pharmaceutical Industry:
1-Pyridin-2-ylmethylpiperidine-4-carboxylic acid ethyl ester is used as a key intermediate in the synthesis of various drugs for its ability to form new pharmaceutical compounds. Its unique structure and functional groups contribute to the development of potential drug candidates with diverse therapeutic applications.
Used in Drug Development:
1-Pyridin-2-ylmethylpiperidine-4-carboxylic acid ethyl ester is used as a building block in drug development for its potential to create new chemical entities with therapeutic properties. Its chemical versatility allows for the design and synthesis of novel compounds with improved pharmacological profiles, including enhanced efficacy, selectivity, and safety.
Used in Medicinal Chemistry Research:
1-Pyridin-2-ylmethylpiperidine-4-carboxylic acid ethyl ester is used as a research tool in medicinal chemistry for the exploration of structure-activity relationships and the optimization of drug candidates. Its unique structural features enable the investigation of various chemical modifications and their impact on biological activity, leading to the discovery of more effective and selective therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 138030-53-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,0,3 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 138030-53:
(8*1)+(7*3)+(6*8)+(5*0)+(4*3)+(3*0)+(2*5)+(1*3)=102
102 % 10 = 2
So 138030-53-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O2/c1-2-18-14(17)12-6-9-16(10-7-12)11-13-5-3-4-8-15-13/h3-5,8,12H,2,6-7,9-11H2,1H3
