138079-73-9 Usage
Derivation from glucose
1-fluoroglucopyranosyl fluoride is derived from a glucose molecule, which is a simple sugar and a primary source of energy for living organisms.
Fluorine attachment
A fluorine atom is attached to the glucose molecule, which may contribute to the compound's unique properties and potential applications.
Antiviral properties
1-fluoroglucopyranosyl fluoride has been studied for its ability to inhibit viral enzymes, making it a potential antiviral agent.
Inhibition of viral enzymes
The compound may interfere with the function of viral enzymes, which are essential for the replication and survival of viruses.
Potential medical applications
Due to its antiviral properties, 1-fluoroglucopyranosyl fluoride may have potential uses in the development of new antiviral medications.
Novel materials development
The compound's unique structure and properties may make it useful in the creation of new materials for various applications.
Chemical synthesis
1-fluoroglucopyranosyl fluoride may be used as a building block or intermediate in the synthesis of other chemical compounds.
Promising target for research
The chemical structure and potential applications of 1-fluoroglucopyranosyl fluoride make it an interesting target for further research in various fields, including medicine, materials science, and chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 138079-73-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,0,7 and 9 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 138079-73:
(8*1)+(7*3)+(6*8)+(5*0)+(4*7)+(3*9)+(2*7)+(1*3)=149
149 % 10 = 9
So 138079-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H10F2O5/c7-6(8)5(12)4(11)3(10)2(1-9)13-6/h2-5,9-12H,1H2/t2-,3-,4+,5-/m1/s1
