138109-87-2 Usage
General Description
The chemical 1,1-bis(4-hydroxyphenyl)-2-iodo-2-phenylethylene, also known as diiododihydroxydiphenylstilbene or as α,α'-dihydroxy-4,4'-diiodostilbene, is a compound that belongs to the stilbene family. It has two hydroxyphenyl groups and one iodine atom attached to a central ethylene carbon bridge. 1,1-bis(4-hydroxyphenyl)-2-iodo-2-phenylethylene has potential applications in various fields such as medicine, organic synthesis, and materials science. It is known for its photochromic properties, meaning it can change color when exposed to certain types of light. Additionally, it has been studied for its potential antioxidant and anticancer properties. However, further research is needed to fully understand its various potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 138109-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,1,0 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 138109-87:
(8*1)+(7*3)+(6*8)+(5*1)+(4*0)+(3*9)+(2*8)+(1*7)=132
132 % 10 = 2
So 138109-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H15IO2/c21-20(16-4-2-1-3-5-16)19(14-6-10-17(22)11-7-14)15-8-12-18(23)13-9-15/h1-13,22-23H/i21-2