13822-63-4 Usage
General Description
The chemical compound "[[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl](methoxymethyl)amino]methanol" is a complex organic molecule with multiple amine and methoxy functional groups. It consists of a 1,3,5-triazine core with multiple methoxymethylamino groups attached to it. The compound also contains a methanol moiety, giving it both hydroxyl and methoxy functionality. This chemical may have potential applications in pharmaceuticals, agrochemicals, and materials science due to its unique structure and functional groups. Further research and analysis are necessary to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 13822-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,8,2 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13822-63:
(7*1)+(6*3)+(5*8)+(4*2)+(3*2)+(2*6)+(1*3)=94
94 % 10 = 4
So 13822-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H28N6O6/c1-22-7-18(6-21)12-15-13(19(8-23-2)9-24-3)17-14(16-12)20(10-25-4)11-26-5/h21H,6-11H2,1-5H3