138498-97-2 Usage
General Description
(Tetrahydro-furan-3-yl)-acetic acid is a chemical substance with a molecular formula of C7H10O3. It is also referred to as 3-(Tetrahydrofuran-3-yl)acetic acid. It's a chemical component that falls under the category of tetrahydrofurans, which are essentially heterocyclic compounds constituted of a five-membered ring containing four carbon atoms and one oxygen atom. The exact properties of (Tetrahydro-furan-3-yl)-acetic acid vary depending on several factors. However, like most tetrahydrofurans, it is typically used in manufacturing various chemical products and in specific scientific research processes due to its versatile chemical structure.
Check Digit Verification of cas no
The CAS Registry Mumber 138498-97-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,4,9 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 138498-97:
(8*1)+(7*3)+(6*8)+(5*4)+(4*9)+(3*8)+(2*9)+(1*7)=182
182 % 10 = 2
So 138498-97-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10O3/c7-6(8)3-5-1-2-9-4-5/h5H,1-4H2,(H,7,8)
138498-97-2Relevant articles and documents
HIV protease inhibitors useful for the treatment of aids
-
, (2008/06/13)
[From equivalent EP0434365A2] Compounds of the form, A-G-B-B-J wherein A is an amine protecting group or urethane, G a dipeptide isostere substituted with a basic amine nitrogen, B an amino acid or analog thereof, and J a small terminal group are describe
