138498-97-2 Usage
Uses
Used in Chemical Manufacturing:
(Tetrahydro-furan-3-yl)-acetic acid is used as a chemical intermediate for the synthesis of various chemical products. Its unique structure allows it to be a key component in the production of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Scientific Research:
(Tetrahydro-furan-3-yl)-acetic acid is employed as a research compound in various scientific studies. Its versatile chemical structure makes it a valuable tool for understanding the properties and reactions of tetrahydrofurans, which can lead to the development of new compounds and applications in different fields.
Used in Pharmaceutical Industry:
(Tetrahydro-furan-3-yl)-acetic acid is used as a building block in the development of new pharmaceutical compounds. Its unique structure can be modified to create novel drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
(Tetrahydro-furan-3-yl)-acetic acid is used as a starting material in the synthesis of agrochemicals, such as pesticides and herbicides. Its versatile structure allows for the creation of new compounds with improved efficacy and reduced environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 138498-97-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,4,9 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 138498-97:
(8*1)+(7*3)+(6*8)+(5*4)+(4*9)+(3*8)+(2*9)+(1*7)=182
182 % 10 = 2
So 138498-97-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10O3/c7-6(8)3-5-1-2-9-4-5/h5H,1-4H2,(H,7,8)
138498-97-2Relevant academic research and scientific papers
HIV protease inhibitors useful for the treatment of aids
-
, (2008/06/13)
[From equivalent EP0434365A2] Compounds of the form, A-G-B-B-J wherein A is an amine protecting group or urethane, G a dipeptide isostere substituted with a basic amine nitrogen, B an amino acid or analog thereof, and J a small terminal group are describe
