138588-23-5 Usage
Uses
Used in Pharmaceutical Industry:
3-(pyrazin-2-yl)-1,2,4-thiadiazol-5-amine is used as a lead compound for the development of new drugs due to its potential biological activities and pharmacological properties. Its unique structure allows it to be a promising candidate for the creation of innovative therapeutic agents that could address various medical conditions.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 3-(pyrazin-2-yl)-1,2,4-thiadiazol-5-amine serves as a valuable research tool for understanding the structure-activity relationships of heterocyclic compounds. Its study can provide insights into the design and synthesis of new drug molecules with improved efficacy and selectivity.
Used in Drug Discovery and Development:
3-(pyrazin-2-yl)-1,2,4-thiadiazol-5-amine is utilized in drug discovery and development processes to identify and optimize potential therapeutic agents. Its heterocyclic nature and pharmacological properties make it a versatile building block for the creation of new chemical entities with diverse biological targets and applications.
Note: The specific applications and industries for 3-(pyrazin-2-yl)-1,2,4-thiadiazol-5-amine are not explicitly mentioned in the provided materials. The uses listed above are inferred based on the compound's potential biological activities and its role in medicinal chemistry. Further research and studies are necessary to determine its exact applications and effectiveness in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 138588-23-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,5,8 and 8 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 138588-23:
(8*1)+(7*3)+(6*8)+(5*5)+(4*8)+(3*8)+(2*2)+(1*3)=165
165 % 10 = 5
So 138588-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N5S/c7-6-10-5(11-12-6)4-3-8-1-2-9-4/h1-3H,(H2,7,10,11)
