138588-23-5 Usage
General Description
3-(pyrazin-2-yl)-1,2,4-thiadiazol-5-amine is a chemical compound with a molecular formula C6H5N5S. It is a heterocyclic compound containing a pyrazine ring and a thiadiazole ring, making it a pyrazinethiadiazole derivative. 3-(pyrazin-2-yl)-1,2,4-thiadiazol-5-amine has potential biological activities and has been studied for its pharmacological properties. Its structure and properties make it potentially useful in medicinal chemistry for the development of new drugs. Further research and studies are needed to fully understand its potential applications and biological effects.
Check Digit Verification of cas no
The CAS Registry Mumber 138588-23-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,5,8 and 8 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 138588-23:
(8*1)+(7*3)+(6*8)+(5*5)+(4*8)+(3*8)+(2*2)+(1*3)=165
165 % 10 = 5
So 138588-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N5S/c7-6-10-5(11-12-6)4-3-8-1-2-9-4/h1-3H,(H2,7,10,11)