138588-24-6 Usage
General Description
3-(pyrimidin-2-yl)-1,2,4-thiadiazol-5-amine is a chemical compound with the molecular formula C6H5N5S. It belongs to the class of organic compounds known as aryl- and aralkyl- thiadiazoles. 3-(pyrimidin-2-yl)-1,2,4-thiadiazol-5-amine is also known as 2-amino-3-(pyrimidin-2-yl)-1,2,4-thiadiazole and it has a molecular weight of 167.198 g/mol. It is a heterocyclic compound with potential applications in pharmaceutical and agrochemical industries. Its structure and properties make it a promising candidate for drug development, as it can potentially exhibit biological activity and therapeutic potential in various diseases. The compound's structure consists of a thiadiazole ring attached to a pyrimidine moiety, and this unique structure provides opportunities for further research and development in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 138588-24-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,5,8 and 8 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 138588-24:
(8*1)+(7*3)+(6*8)+(5*5)+(4*8)+(3*8)+(2*2)+(1*4)=166
166 % 10 = 6
So 138588-24-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N5S/c7-6-10-5(11-12-6)4-8-2-1-3-9-4/h1-3H,(H2,7,10,11)