138668-18-5 Usage
Uses
Used in Organic Synthesis:
(E)-2-Nitro-2-penten-1-ol is used as a key intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows for a wide range of reactions, making it a valuable building block in the synthesis of complex molecules.
Used in Pharmaceutical Production:
In the pharmaceutical industry, (E)-2-Nitro-2-penten-1-ol is utilized as a starting material or intermediate in the synthesis of various drugs. Its ability to be modified and functionalized makes it a promising candidate for the development of new medications.
Used in Agrochemical Production:
(E)-2-Nitro-2-penten-1-ol also finds applications in the agrochemical sector, where it is used in the synthesis of pesticides, herbicides, and other agricultural chemicals. Its versatility in chemical reactions enables the creation of effective and targeted products for crop protection.
Used as a Chiral Auxiliary in Asymmetric Synthesis:
(E)-2-Nitro-2-penten-1-ol is recognized for its potential use as a chiral auxiliary in asymmetric synthesis. This application is significant in the development of enantiomerically pure compounds, which are essential in various fields, including pharmaceuticals and materials science.
Used in Antimicrobial Products:
(E)-2-Nitro-2-penten-1-ol has been studied for its antimicrobial and antifungal properties, showing promise as a potential ingredient in antimicrobial products. Its ability to inhibit the growth of harmful microorganisms makes it a valuable addition to the development of new antimicrobial formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 138668-18-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,6,6 and 8 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 138668-18:
(8*1)+(7*3)+(6*8)+(5*6)+(4*6)+(3*8)+(2*1)+(1*8)=165
165 % 10 = 5
So 138668-18-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NO3/c1-2-3-5(4-7)6(8)9/h3,7H,2,4H2,1H3/b5-3-