138751-02-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Methyl-D-norleucine is used as a pharmaceutical compound for its potential applications in drug development. Its unique structure as a D-alpha-amino acid may offer novel therapeutic opportunities in the treatment of various diseases.
Used in Research Applications:
5-Methyl-D-norleucine is used as a research tool in the field of biochemistry and molecular biology. Its enantiomer nature and amino acid structure make it a valuable compound for studying protein interactions, enzyme specificity, and other biological processes.
Used in Chemical Synthesis:
5-Methyl-D-norleucine is used as a building block in the synthesis of more complex organic compounds. Its unique structure can be incorporated into various chemical reactions, potentially leading to the development of new drugs and materials.
Used in Nutritional Supplements:
5-Methyl-D-norleucine is used as a nutritional supplement, particularly for its potential role in supporting muscle growth and function. Its amino acid structure may contribute to the body's protein synthesis and overall health.
Used in Cosmetic Industry:
5-Methyl-D-norleucine is used as an ingredient in cosmetic products, such as skincare and hair care formulations. Its potential benefits for skin health and appearance may be explored in various cosmetic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 138751-02-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,7,5 and 1 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 138751-02:
(8*1)+(7*3)+(6*8)+(5*7)+(4*5)+(3*1)+(2*0)+(1*2)=137
137 % 10 = 7
So 138751-02-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO2/c1-5(2)3-4-6(8)7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t6-/m1/s1
