138751-02-7 Usage
General Description
5-Methyl-D-norleucine, also known as D-Norleucine, 5-Methyl-, is a chemical compound with the molecular formula C7H15NO2. 5-Methyl-D-norleucine, containing an amino acid structure, belongs to the class of organic compounds known as D-alpha-amino acids. These are alpha amino acids where the alpha carbon atom has D-configuration. It's an enantiomer, meaning it is a molecule that is the mirror image of another molecule but cannot be superimposed on it. The detailed information about this chemical's properties, including its solubility, melting point, boiling point, and toxicity, are not widely recorded in literature.
Check Digit Verification of cas no
The CAS Registry Mumber 138751-02-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,7,5 and 1 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 138751-02:
(8*1)+(7*3)+(6*8)+(5*7)+(4*5)+(3*1)+(2*0)+(1*2)=137
137 % 10 = 7
So 138751-02-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO2/c1-5(2)3-4-6(8)7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t6-/m1/s1
