138783-15-0 Usage
General Description
(Glutamyl-glutamyl-asparaginyl-valyl)6 is a chemical compound consisting of six repetitions of the peptide sequence glutamyl-glutamyl-asparaginyl-valyl. This sequence is formed by linking together the amino acids glutamic acid, asparagine, and valine in a specific order. These amino acids are essential building blocks of proteins and play important roles in various biological processes in the body. The repetition of this sequence six times creates a complex peptide with potential implications for biochemical and pharmaceutical research. Further investigation into the properties and potential applications of (glutamyl-glutamyl-asparaginyl-valyl)6 could provide valuable insights into its biological and chemical functions.
Check Digit Verification of cas no
The CAS Registry Mumber 138783-15-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,7,8 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 138783-15:
(8*1)+(7*3)+(6*8)+(5*7)+(4*8)+(3*3)+(2*1)+(1*5)=160
160 % 10 = 0
So 138783-15-0 is a valid CAS Registry Number.
InChI:InChI=1/C114H176N30O55/c1-43(2)85(139-101(181)61(37-67(120)145)133-94(174)52(118)16-28-76(157)158)107(187)130-56(20-32-80(165)166)96(176)129-58(100(180)136-64(40-70(123)148)104(184)142-88(46(7)8)110(190)191)22-33-81(167)196-111(192)59(131-108(188)86(44(3)4)140-102(182)62(38-68(121)146)134-95(175)53(119)17-29-77(159)160)23-35-82(168)197-112(193)60(132-109(189)87(45(5)6)141-103(183)63(39-69(122)147)135-97(177)54(18-30-78(161)162)126-91(171)49(115)13-25-73(151)152)24-36-84(170)199-114(195)90(48(11)12)144-106(186)66(42-72(125)150)138-99(179)57(128-93(173)51(117)15-27-75(155)156)21-34-83(169)198-113(194)89(47(9)10)143-105(185)65(41-71(124)149)137-98(178)55(19-31-79(163)164)127-92(172)50(116)14-26-74(153)154/h43-66,85-90H,13-42,115-119H2,1-12H3,(H2,120,145)(H2,121,146)(H2,122,147)(H2,123,148)(H2,124,149)(H2,125,150)(H,126,171)(H,127,172)(H,128,173)(H,129,176)(H,130,187)(H,131,188)(H,132,189)(H,133,174)(H,134,175)(H,135,177)(H,136,180)(H,137,178)(H,138,179)(H,139,181)(H,140,182)(H,141,183)(H,142,184)(H,143,185)(H,14