138800-17-6 Usage
Cationic compound
It carries a positive charge, which allows it to interact with negatively charged species or anions.
Phosphorus atom
The presence of a phosphorus atom in the compound contributes to its chemical reactivity and coordination properties.
Four nitrogen atoms
The nitrogen atoms play a crucial role in binding to metal ions, forming stable complexes.
Used as a ligand in coordination chemistry
It can bind to metal ions, forming stable complexes, which is essential in various chemical reactions and applications.
Potential applications in catalysis
The compound may be used to increase the rate of chemical reactions, making industrial processes more efficient.
Chelating agent
It can bind to metal ions, forming complexes that can be used in various chemical reactions, such as extraction or separation processes.
Medicinal and pharmaceutical research
The structure and properties of the compound have been investigated for potential use in the development of new drugs and therapies.
Stability
The compound is known for forming stable complexes with metal ions, which is a desirable property in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 138800-17-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,8,0 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 138800-17:
(8*1)+(7*3)+(6*8)+(5*8)+(4*0)+(3*0)+(2*1)+(1*7)=126
126 % 10 = 6
So 138800-17-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H21N4P.ClH/c1-10-4-7-13-8-5-11(2)14(10)12(3)6-9-13;/h4-9H2,1-3H3;1H