13892-51-8 Usage
General Description
3-Oxo-2-(thiophene-2-carbonyl)-butyric acid ethyl ester is a chemical compound that is commonly used in the pharmaceutical and chemical industries. It is a derivative of butyric acid and thiophene-2-carbonyl, and is often utilized for its potential medicinal properties. 3-Oxo-2-(thiophene-2-carbonyl)-butyric acid ethyl ester is known for its anti-inflammatory and anti-microbial actions, and is currently being studied for its potential applications in treating various diseases and conditions. Additionally, it is often used as a building block in the synthesis of other organic compounds, making it a valuable tool in organic chemistry research. Overall, 3-Oxo-2-(thiophene-2-carbonyl)-butyric acid ethyl ester has diverse applications and plays a significant role in the development of new pharmaceuticals and chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 13892-51-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,8,9 and 2 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13892-51:
(7*1)+(6*3)+(5*8)+(4*9)+(3*2)+(2*5)+(1*1)=118
118 % 10 = 8
So 13892-51-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O4S/c1-3-15-11(14)9(7(2)12)10(13)8-5-4-6-16-8/h4-6,9H,3H2,1-2H3
